EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10FN3O3 |
| Net Charge | 0 |
| Average Mass | 227.195 |
| Monoisotopic Mass | 227.07062 |
| SMILES | Nc1nc(=O)n([C@@H]2C=C[C@H](CO)O2)cc1F |
| InChI | InChI=1S/C9H10FN3O3/c10-6-3-13(9(15)12-8(6)11)7-2-1-5(4-14)16-7/h1-3,5,7,14H,4H2,(H2,11,12,15)/t5-,7+/m1/s1 |
| InChIKey | HSBKFSPNDWWPSL-VDTYLAMSSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elvucitabine (CHEBI:748177) has role anti-HBV agent (CHEBI:64951) |
| elvucitabine (CHEBI:748177) has role anti-HIV agent (CHEBI:64946) |
| elvucitabine (CHEBI:748177) is a carbohydrate derivative (CHEBI:63299) |
| elvucitabine (CHEBI:748177) is a nucleobase-containing molecular entity (CHEBI:61120) |
| INNs | Source |
|---|---|
| elvucitabina | WHO MedNet |
| elvucitabine | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACH-126,443 | ChEMBL |
| ACH-126443 | ChEMBL |
| .beta.-l-fd4c | ChEMBL |
| Beta-l-fd4c | ChEMBL |
| L-fd4c | ChEMBL |
| Citations |
|---|