EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4S |
| Net Charge | 0 |
| Average Mass | 236.293 |
| Monoisotopic Mass | 236.08308 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c1-15-3-2-6(8(13)14)10-7(12)5(9)4-11/h5-6,11H,2-4,9H2,1H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | PBUXMVYWOSKHMF-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Met (CHEBI:74817) has role metabolite (CHEBI:25212) |
| Ser-Met (CHEBI:74817) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-methionine |
| Synonyms | Source |
|---|---|
| SM | ChEBI |
| L-Ser-L-Met | ChEBI |
| serylmethionine | ChEBI |
| N-L-seryl-L-methionine | ChemIDplus |
| Serinyl-Methionine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029045 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1712896 | Reaxys |
| CAS:3227-09-6 | ChemIDplus |