EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10IN3 |
| Net Charge | 0 |
| Average Mass | 275.093 |
| Monoisotopic Mass | 274.99195 |
| SMILES | N=C(N)NCc1cccc(I)c1 |
| InChI | InChI=1S/C8H10IN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12) |
| InChIKey | PDWUPXJEEYOOTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iobenguane (CHEBI:748159) has role antineoplastic agent (CHEBI:35610) |
| iobenguane (CHEBI:748159) has role cardiovascular drug (CHEBI:35554) |
| iobenguane (CHEBI:748159) is a organoiodine compound (CHEBI:37142) |
| Synonym | Source |
|---|---|
| Iobenguane (127-i) | ChEMBL |
| Citations |
|---|