EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748158 - sutezolid
| Formula | C16H20FN3O3S |
| Net Charge | 0 |
| Average Mass | 353.419 |
| Monoisotopic Mass | 353.12094 |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCSCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN3O3S/c1-11(21)18-9-13-10-20(16(22)23-13)12-2-3-15(14(17)8-12)19-4-6-24-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | FNDDDNOJWPQCBZ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sutezolid (CHEBI:748158) has role antitubercular agent (CHEBI:33231) |
| sutezolid (CHEBI:748158) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| sutezolid (CHEBI:748158) is a organosulfur heterocyclic compound (CHEBI:38106) |
| INN | Source |
|---|---|
| sutezolid | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-742407 | ChEMBL |
| Oxazolidininone | ChEMBL |
| PNU-100480 | ChEMBL |
| U 100480 | ChEMBL |
| U-100480 | ChEMBL |
| U100480 | ChEMBL |
| Citations |
|---|