EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H68N6O6S |
| Net Charge | 0 |
| Average Mass | 785.109 |
| Monoisotopic Mass | 784.49210 |
| SMILES | [H][C@@]1([C@H](OC)[C@@H](C)C(=O)N[C@@H](Cc2ccccc2)c2nccs2)CCCN1C(=O)C[C@@H](OC)[C@H]([C@@H](C)CC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C)C(C)C |
| InChI | InChI=1S/C42H68N6O6S/c1-13-28(6)37(47(10)42(52)35(26(2)3)45-40(51)36(27(4)5)46(8)9)33(53-11)25-34(49)48-22-17-20-32(48)38(54-12)29(7)39(50)44-31(41-43-21-23-55-41)24-30-18-15-14-16-19-30/h14-16,18-19,21,23,26-29,31-33,35-38H,13,17,20,22,24-25H2,1-12H3,(H,44,50)(H,45,51)/t28-,29+,31-,32-,33+,35-,36-,37-,38+/m0/s1 |
| InChIKey | OFDNQWIFNXBECV-VFSYNPLYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dolastatin-10 (CHEBI:748154) has role antineoplastic agent (CHEBI:35610) |
| dolastatin-10 (CHEBI:748154) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| Dolastatin 10 | ChEMBL |
| Dolostatin 10 | ChEMBL |
| Citations |
|---|