EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748152 - tametraline
| Formula | C17H19N |
| Net Charge | 0 |
| Average Mass | 237.346 |
| Monoisotopic Mass | 237.15175 |
| SMILES | CN[C@@H]1CC[C@@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H19N/c1-18-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17/h2-10,14,17-18H,11-12H2,1H3/t14-,17+/m0/s1 |
| InChIKey | NVXPZMLRGBVYQV-WMLDXEAASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tametraline (CHEBI:748152) is a tetralins (CHEBI:36786) |
| INNs | Source |
|---|---|
| tametralina | WHO MedNet |
| tametraline | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-24,441 | ChEMBL |
| CP-24441 | ChEMBL |
| Citations |
|---|