EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C18H19O8P.Na |
| Net Charge | 0 |
| Average Mass | 440.296 |
| Monoisotopic Mass | 440.06129 |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C18H21O8P.2Na/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;;/h5-11H,1-4H3,(H2,19,20,21);;/q;2*+1/p-2/b6-5-;; |
| InChIKey | VXNQMUVMEIGUJW-XNOMRPDFSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosbretabulin disodium (CHEBI:748146) has role antineoplastic agent (CHEBI:35610) |
| fosbretabulin disodium (CHEBI:748146) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| CA-4DP | ChEMBL |
| CA4DP | ChEMBL |
| CA 4P | ChEMBL |
| Fosbretabulin disodium | ChEMBL |
| Fosbretabulin disodium salt | ChEMBL |
| Citations |
|---|