EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O2 |
| Net Charge | 0 |
| Average Mass | 220.312 |
| Monoisotopic Mass | 220.14633 |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C)O2 |
| InChI | InChI=1S/C14H20O2/c1-8-9(2)13-11(10(3)12(8)15)6-7-14(4,5)16-13/h15H,6-7H2,1-5H3 |
| InChIKey | SEBPXHSZHLFWRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apc-100 (CHEBI:748145) has role antineoplastic agent (CHEBI:35610) |
| apc-100 (CHEBI:748145) is a 1-benzopyran (CHEBI:38443) |
| Synonyms | Source |
|---|---|
| 2,2,5,7,9-pentamethyl-6-chromanol | ChEMBL |
| APC-100 | ChEMBL |
| Chromane c1 | ChEMBL |
| NSC-226236 | ChEMBL |
| Citations |
|---|