EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H33N3O5S2 |
| Net Charge | 0 |
| Average Mass | 615.777 |
| Monoisotopic Mass | 615.18616 |
| SMILES | [H][C@]12C[C@](O)(C(=O)OC)[C@](C)(O1)n1c3ccc(CSCC)cc3c3c4c(c5c6cc(CSCC)ccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C33H33N3O5S2/c1-5-42-15-17-7-9-22-19(11-17)26-27-21(14-34-30(27)37)25-20-12-18(16-43-6-2)8-10-23(20)36-29(25)28(26)35(22)24-13-33(39,31(38)40-4)32(36,3)41-24/h7-12,24,39H,5-6,13-16H2,1-4H3,(H,34,37)/t24-,32+,33+/m1/s1 |
| InChIKey | SCMLRESZJCKCTC-KMYQRJGFSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-1347 (CHEBI:748143) has role antiparkinson drug (CHEBI:48407) |
| cep-1347 (CHEBI:748143) is a indolocarbazole (CHEBI:51915) |
| Synonyms | Source |
|---|---|
| 3,9-bis((ethylthio)methyl)-k-252a | ChEMBL |
| Cep-1347 | ChEMBL |
| KT-1575 | ChEMBL |
| KT-7515 | ChEMBL |
| KT7515 | ChEMBL |
| Citations |
|---|