EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O4 |
| Net Charge | 0 |
| Average Mass | 162.145 |
| Monoisotopic Mass | 162.06406 |
| SMILES | N[C@@H](CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-3(2-8)5(11)7-1-4(9)10/h3,8H,1-2,6H2,(H,7,11)(H,9,10)/t3-/m0/s1 |
| InChIKey | WOUIMBGNEUWXQG-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Gly (CHEBI:74814) has role metabolite (CHEBI:25212) |
| Ser-Gly (CHEBI:74814) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-serylglycine |
| Synonyms | Source |
|---|---|
| L-Ser-Gly | ChEBI |
| SG | ChEBI |
| serylglycine | ChEBI |
| Serinyl-Glycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029039 | HMDB |
| CPD-12607 | MetaCyc |