EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO4S |
| Net Charge | 0 |
| Average Mass | 253.279 |
| Monoisotopic Mass | 253.04088 |
| SMILES | C[C@]1(C(=O)O)CSC(c2ccc(O)cc2O)=N1 |
| InChI | InChI=1S/C11H11NO4S/c1-11(10(15)16)5-17-9(12-11)7-3-2-6(13)4-8(7)14/h2-4,13-14H,5H2,1H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | OEUUFNIKLCFNLN-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferitrin (CHEBI:748136) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| deferitrin | WHO MedNet |
| deferitrina | WHO MedNet |
| deferitrine | WHO MedNet |
| Synonyms | Source |
|---|---|
| GT-56-252 | ChEMBL |
| GT56-252 | ChEMBL |
| Citations |
|---|