EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748132 - lometrexol
| Formula | C21H25N5O6 |
| Net Charge | 0 |
| Average Mass | 443.460 |
| Monoisotopic Mass | 443.18048 |
| SMILES | Nc1nc2c(c(=O)n1)C[C@@H](CCc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C21H25N5O6/c22-21-25-17-14(19(30)26-21)9-12(10-23-17)2-1-11-3-5-13(6-4-11)18(29)24-15(20(31)32)7-8-16(27)28/h3-6,12,15H,1-2,7-10H2,(H,24,29)(H,27,28)(H,31,32)(H4,22,23,25,26,30)/t12-,15+/m1/s1 |
| InChIKey | ZUQBAQVRAURMCL-DOMZBBRYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lometrexol (CHEBI:748132) has role antineoplastic agent (CHEBI:35610) |
| lometrexol (CHEBI:748132) is a glutamic acid derivative (CHEBI:24315) |
| Synonyms | Source |
|---|---|
| Lometrexol | ChEMBL |
| LY264618 | ChEMBL |
| Citations |
|---|