EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c9-4(3-11)7(14)10-5(8(15)16)1-2-6(12)13/h4-5,11H,1-3,9H2,(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | LAFKUZYWNCHOHT-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Glu (CHEBI:74813) has role metabolite (CHEBI:25212) |
| Ser-Glu (CHEBI:74813) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| SE | ChEBI |
| Serinyl-Glutamate | HMDB |
| serylglutamic acid | ChEBI |
| L-Ser-L-Glu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029038 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728923 | Reaxys |