EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O3 |
| Net Charge | 0 |
| Average Mass | 410.598 |
| Monoisotopic Mass | 410.28210 |
| SMILES | [H][C@@]12CC=C([C@H](C)CC#CC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C27H38O3/c1-18(8-6-14-26(3,4)30)23-12-13-24-20(9-7-15-27(23,24)5)10-11-21-16-22(28)17-25(29)19(21)2/h10-12,18,22,24-25,28-30H,2,7-9,13,15-17H2,1,3-5H3/b20-10+,21-11-/t18-,22-,24+,25+,27-/m1/s1 |
| InChIKey | JKFZMIQMKFWJAY-RQJQXFIZSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilx23-7553 (CHEBI:748128) is a vitamin D (CHEBI:27300) |
| Synonyms | Source |
|---|---|
| BXL 353 | ChEMBL |
| BXL-353 | ChEMBL |
| ILEX-23-7553 | ChEMBL |
| Ilx 237553 | ChEMBL |
| Ilx23-7553 | ChEMBL |
| ILX-23-7553 | ChEMBL |