EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748127 - octenidine hydrochloride
| Formula | HCl.C36H62N4.HCl |
| Net Charge | 0 |
| Average Mass | 623.842 |
| Monoisotopic Mass | 622.45080 |
| SMILES | CCCCCCCCN=c1ccn(CCCCCCCCCCn2ccc(=NCCCCCCCC)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C36H62N4.2ClH/c1-3-5-7-9-15-19-27-37-35-23-31-39(32-24-35)29-21-17-13-11-12-14-18-22-30-40-33-25-36(26-34-40)38-28-20-16-10-8-6-4-2;;/h23-26,31-34H,3-22,27-30H2,1-2H3;2*1H |
| InChIKey | SMGTYJPMKXNQFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octenidine hydrochloride (CHEBI:748127) has role antifungal agent (CHEBI:35718) |
| octenidine hydrochloride (CHEBI:748127) has role antifungal drug (CHEBI:86327) |
| octenidine hydrochloride (CHEBI:748127) has role dermatologic drug (CHEBI:50177) |
| octenidine hydrochloride (CHEBI:748127) is a methylpyridines (CHEBI:25340) |
| Synonyms | Source |
|---|---|
| LAS-189962 | ChEMBL |
| LAS189962 | ChEMBL |
| Octenidine dihydrochloride | ChEMBL |
| Octenidine hcl | ChEMBL |
| Octenidine hydrochloride | ChEMBL |
| Sensidin do | ChEMBL |
| Citations |
|---|