EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | Oc1ccc([C@@H]2CC(O)c3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,12-13,16-19H,7H2/t12?,13-/m0/s1 |
| InChIKey | RPKUCYSGAXIESU-ABLWVSNPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apiforol (CHEBI:74812) has role metabolite (CHEBI:25212) |
| apiforol (CHEBI:74812) is a tetrahydroxyflavan (CHEBI:72011) |
| IUPAC Name |
|---|
| (2S)-2-(4-hydroxyphenyl)chromane-4,5,7-triol |
| Synonyms | Source |
|---|---|
| (2S)-apiforol | ChEBI |
| Apiforol | KEGG COMPOUND |
| flavan-4,4',5,7-tetrol | ChEBI |
| leucoapigeninidin | MetaCyc |