EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748119 - carzelesin
| Formula | C41H37ClN6O5 |
| Net Charge | 0 |
| Average Mass | 729.237 |
| Monoisotopic Mass | 728.25140 |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccc4nc(C(=O)N5C[C@@H](CCl)c6c5cc(OC(=O)Nc5ccccc5)c5ncc(C)c65)cc4c3)oc2c1 |
| InChI | InChI=1S/C41H37ClN6O5/c1-4-47(5-2)29-13-11-24-17-35(52-33(24)18-29)39(49)44-28-12-14-30-25(15-28)16-31(46-30)40(50)48-22-26(20-42)37-32(48)19-34(38-36(37)23(3)21-43-38)53-41(51)45-27-9-7-6-8-10-27/h6-19,21,26,43,46H,4-5,20,22H2,1-3H3,(H,44,49)(H,45,51)/t26-/m1/s1 |
| InChIKey | BBZDXMBRAFTCAA-AREMUKBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carzelesin (CHEBI:748119) is a indolyl carboxylic acid (CHEBI:46867) |
| INNs | Source |
|---|---|
| carzelesin | WHO MedNet |
| carzelesina | WHO MedNet |
| carzelesine | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-619029 | ChEMBL |
| U-80244 | ChEMBL |
| Citations |
|---|