EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO3Si2 |
| Net Charge | 0 |
| Average Mass | 385.612 |
| Monoisotopic Mass | 385.15295 |
| SMILES | C[Si](C)(C)c1cc(C(=O)Nc2ccc(C(=O)O)cc2)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C20H27NO3Si2/c1-25(2,3)17-11-15(12-18(13-17)26(4,5)6)19(22)21-16-9-7-14(8-10-16)20(23)24/h7-13H,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | VVTNSTLJOVCBDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amsilarotene (CHEBI:748112) has role antineoplastic agent (CHEBI:35610) |
| amsilarotene (CHEBI:748112) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| AM-555S | ChEMBL |
| AM555S | ChEMBL |
| Amsilarotene | ChEMBL |
| Tac-101 | ChEMBL |
| TAC101 | ChEMBL |
| Citations |
|---|