EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 441.355 |
| Monoisotopic Mass | 440.12696 |
| SMILES | O=C(O)CC[C@@H](NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C21H26Cl2N2O4/c22-15-11-14(12-16(23)13-15)19(28)24-17(3-4-18(26)27)20(29)25-9-7-21(8-10-25)5-1-2-6-21/h11-13,17H,1-10H2,(H,24,28)(H,26,27)/t17-/m1/s1 |
| InChIKey | FJCZHMXAGBYXHJ-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiroglumide (CHEBI:748106) is a N-acylglycine (CHEBI:16180) |
| INNs | Source |
|---|---|
| espiroglumida | WHO MedNet |
| spiroglumide | WHO MedNet |
| Synonyms | Source |
|---|---|
| CR-2194 | ChEMBL |
| CR2194 | ChEMBL |
| Citations |
|---|