EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO2 |
| Net Charge | 0 |
| Average Mass | 281.355 |
| Monoisotopic Mass | 281.14158 |
| SMILES | O=C(O)CCCC/C=C(/c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C18H19NO2/c20-18(21)12-6-2-5-11-17(15-8-3-1-4-9-15)16-10-7-13-19-14-16/h1,3-4,7-11,13-14H,2,5-6,12H2,(H,20,21)/b17-11- |
| InChIKey | UWPBQLKEHGGKKD-BOPFTXTBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isbogrel (CHEBI:748088) is a medium-chain fatty acid (CHEBI:59554) |
| INN | Source |
|---|---|
| isbogrel | WHO MedNet |
| Citations |
|---|