EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O5 |
| Net Charge | 0 |
| Average Mass | 233.224 |
| Monoisotopic Mass | 233.10117 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C8H15N3O5/c9-4(3-12)7(14)11-5(8(15)16)1-2-6(10)13/h4-5,12H,1-3,9H2,(H2,10,13)(H,11,14)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | UJTZHGHXJKIAOS-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Gln (CHEBI:74808) has role metabolite (CHEBI:25212) |
| Ser-Gln (CHEBI:74808) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-glutamine |
| Synonyms | Source |
|---|---|
| serylglutamine | ChEBI |
| SQ | ChEBI |
| L-Ser-L-Gln | ChEBI |
| Serinyl-Glutamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029037 | HMDB |