EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O |
| Net Charge | 0 |
| Average Mass | 184.238 |
| Monoisotopic Mass | 184.08882 |
| SMILES | O=C1C2=C(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C13H12O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1,3,5,7H,2,4,6,8H2 |
| InChIKey | PWTXAEYNCISTMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phentydrone (CHEBI:748063) is a fluorenes (CHEBI:24059) |
| Synonym | Source |
|---|---|
| Phentydrone | ChEMBL |
| Citations |
|---|