EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23ClN2O4 |
| Net Charge | 0 |
| Average Mass | 402.878 |
| Monoisotopic Mass | 402.13463 |
| SMILES | C[C@H](Cc1cnc2c(OCC(=O)O)cccc12)NC[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-13(23-11-18(25)14-4-2-5-16(22)9-14)8-15-10-24-21-17(15)6-3-7-19(21)28-12-20(26)27/h2-7,9-10,13,18,23-25H,8,11-12H2,1H3,(H,26,27)/t13-,18+/m1/s1 |
| InChIKey | FHEYFIGWYQJVDR-ACJLOTCBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rafabegron (CHEBI:748056) is a monocarboxylic acid (CHEBI:25384) |
| INN | Source |
|---|---|
| rafabegron | WHO MedNet |
| Synonyms | Source |
|---|---|
| AD-9677 | ChEMBL |
| Aj-9677 | ChEMBL |
| TAK-677 | ChEMBL |
| Citations |
|---|