EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748055 - teloxantrone
| Formula | C21H25N5O4 |
| Net Charge | 0 |
| Average Mass | 411.462 |
| Monoisotopic Mass | 411.19065 |
| SMILES | CNCCNc1ccc2c3c(nn2CCNCCO)-c2c(O)ccc(O)c2C(=O)c13 |
| InChI | InChI=1S/C21H25N5O4/c1-22-6-7-24-12-2-3-13-17-16(12)21(30)19-15(29)5-4-14(28)18(19)20(17)25-26(13)10-8-23-9-11-27/h2-5,22-24,27-29H,6-11H2,1H3 |
| InChIKey | XASBSYHEEHVCSJ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teloxantrone (CHEBI:748055) is a anthracenes (CHEBI:46955) |
| INNs | Source |
|---|---|
| teloxantrona | WHO MedNet |
| teloxantrone | WHO MedNet |
| Synonyms | Source |
|---|---|
| CI-937 | ChEMBL |
| CI937 | ChEMBL |
| PD-113309 | ChEMBL |
| PD113309 | ChEMBL |
| Citations |
|---|