EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N5O2 |
| Net Charge | 0 |
| Average Mass | 379.464 |
| Monoisotopic Mass | 379.20083 |
| SMILES | CCNc1cccnc1N1CCN(C(=O)c2cc3cc(OC)ccc3n2)CC1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-22-18-5-4-8-23-20(18)25-9-11-26(12-10-25)21(27)19-14-15-13-16(28-2)6-7-17(15)24-19/h4-8,13-14,22,24H,3,9-12H2,1-2H3 |
| InChIKey | UCPOMLWZWRTIAA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atevirdine mesylate (CHEBI:748053) has role anti-HIV agent (CHEBI:64946) |
| atevirdine mesylate (CHEBI:748053) is a piperazines (CHEBI:26144) |
| atevirdine mesylate (CHEBI:748053) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| atevirdina | WHO MedNet |
| atevirdine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Atevirdine mesilate | ChEMBL |
| Atevirdine mesylate | ChEMBL |
| Atevirdine methanesulfonate | ChEMBL |
| U-87201E | ChEMBL |
| Citations |
|---|