EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N2O6 |
| Net Charge | 0 |
| Average Mass | 410.426 |
| Monoisotopic Mass | 410.14779 |
| SMILES | COc1cc(OC)nc(O[C@H](C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N2O6/c1-27-17-14-18(28-2)24-21(23-17)30-19(20(25)26)22(29-3,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14,19H,1-3H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | FEJVSJIALLTFRP-LJQANCHMSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darusentan (CHEBI:748045) has role antihypertensive agent (CHEBI:35674) |
| darusentan (CHEBI:748045) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| darusentan | WHO MedNet |
| Synonyms | Source |
|---|---|
| HMR-4005 | ChEMBL |
| LU-135252 | ChEMBL |
| Citations |
|---|