EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 282.126 |
| Monoisotopic Mass | 281.00103 |
| SMILES | O=C(O)c1ccccc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2NO2/c14-9-5-3-7-11(12(9)15)16-10-6-2-1-4-8(10)13(17)18/h1-7,16H,(H,17,18) |
| InChIKey | JONFYSWOLCTYFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofenamic acid (CHEBI:748042) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| acide clofenamique | WHO MedNet |
| acido clofenamico | WHO MedNet |
| clofenamic acid | WHO MedNet |
| Citations |
|---|