EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748040 - tretazicar
| Formula | C9H8N4O5 |
| Net Charge | 0 |
| Average Mass | 252.186 |
| Monoisotopic Mass | 252.04947 |
| SMILES | NC(=O)c1cc(N2CC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N4O5/c10-9(14)5-3-7(11-1-2-11)8(13(17)18)4-6(5)12(15)16/h3-4H,1-2H2,(H2,10,14) |
| InChIKey | WOCXQMCIOTUMJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tretazicar (CHEBI:748040) has role antineoplastic agent (CHEBI:35610) |
| tretazicar (CHEBI:748040) is a nitroaniline (CHEBI:25550) |
| INN | Source |
|---|---|
| tretazicar | WHO MedNet |
| Synonyms | Source |
|---|---|
| CB-1954 | ChEMBL |
| NSC-115829 | ChEMBL |
| Citations |
|---|