EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C4H12NO7P2 |
| Net Charge | 0 |
| Average Mass | 271.078 |
| Monoisotopic Mass | 270.99867 |
| SMILES | NCCCC(O)(P(=O)([O-])O)P(=O)(O)O.[Na+] |
| InChI | InChI=1S/C4H13NO7P2.Na/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);/q;+1/p-1 |
| InChIKey | CAKRAHQRJGUPIG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alendronate sodium (CHEBI:748035) has role antineoplastic agent (CHEBI:35610) |
| alendronate sodium (CHEBI:748035) has role bone density conservation agent (CHEBI:50646) |
| alendronate sodium (CHEBI:748035) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| Synonyms | Source |
|---|---|
| Adrovance | ChEMBL |
| Alendronate (as sodium) | ChEMBL |
| Alendronate sodium | ChEMBL |
| Alendronic acid monosodium salt trihydrate | ChEMBL |
| Fosavance | ChEMBL |
| G-704,650 | ChEMBL |
| Brand Name | Source |
|---|---|
| Alendronate sodium component of fosamax plus d | ChEMBL |
| Citations |
|---|