EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O5 |
| Net Charge | 0 |
| Average Mass | 219.197 |
| Monoisotopic Mass | 219.08552 |
| SMILES | NC(=O)C[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C7H13N3O5/c8-3(2-11)6(13)10-4(7(14)15)1-5(9)12/h3-4,11H,1-2,8H2,(H2,9,12)(H,10,13)(H,14,15)/t3-,4-/m0/s1 |
| InChIKey | LTFSLKWFMWZEBD-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Asn (CHEBI:74802) has role metabolite (CHEBI:25212) |
| Ser-Asn (CHEBI:74802) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-asparagine |
| Synonyms | Source |
|---|---|
| Serinyl-Asparagine | HMDB |
| serylasparagine | ChEBI |
| L-Ser-L-Asn | ChEBI |
| SN | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029034 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5537349 | Reaxys |