EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O3 |
| Net Charge | 0 |
| Average Mass | 214.265 |
| Monoisotopic Mass | 214.13174 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C10H18N2O3/c1-6(2)8(10(14)15)12-9(13)7-4-3-5-11-7/h6-8,11H,3-5H2,1-2H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | AWJGUZSYVIVZGP-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Val (CHEBI:74800) has role metabolite (CHEBI:25212) |
| Pro-Val (CHEBI:74800) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-valine |
| Synonyms | Source |
|---|---|
| prolylvaline | ChEBI |
| L-Pro-L-Val | ChEBI |
| PV | ChEBI |
| Prolyl-Valine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029030 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4442146 | Reaxys |
| CAS:20488-27-1 | ChemIDplus |