EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO3 |
| Net Charge | 0 |
| Average Mass | 327.424 |
| Monoisotopic Mass | 327.18344 |
| SMILES | C[C@@H]([C@@H](O)c1ccc(O)cc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25NO3/c1-15(19(23)16-7-9-18(22)10-8-16)21-13-11-20(24,12-14-21)17-5-3-2-4-6-17/h2-10,15,19,22-24H,11-14H2,1H3/t15-,19+/m0/s1 |
| InChIKey | QEMSVZNTSXPFJA-HNAYVOBHSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| traxoprodil (CHEBI:747998) has role antidepressant (CHEBI:35469) |
| traxoprodil (CHEBI:747998) has role antiparkinson drug (CHEBI:48407) |
| traxoprodil (CHEBI:747998) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| traxoprodil | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-101,606 | ChEMBL |
| CP-101606 | ChEMBL |
| Citations |
|---|