EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:747994 - pelrinone
| Formula | C12H11N5O |
| Net Charge | 0 |
| Average Mass | 241.254 |
| Monoisotopic Mass | 241.09636 |
| SMILES | Cc1nc(NCc2cccnc2)c(C#N)c(=O)n1 |
| InChI | InChI=1S/C12H11N5O/c1-8-16-11(10(5-13)12(18)17-8)15-7-9-3-2-4-14-6-9/h2-4,6H,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | NZXHFDXOCVIYLO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelrinone (CHEBI:747994) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| INNs | Source |
|---|---|
| pelrinona | WHO MedNet |
| pelrinone | WHO MedNet |
| Citations |
|---|