EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClN5O |
| Net Charge | 0 |
| Average Mass | 371.872 |
| Monoisotopic Mass | 371.15129 |
| SMILES | N#CN=C(NCCCCCCOc1ccc(Cl)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C19H22ClN5O/c20-16-5-7-18(8-6-16)26-14-4-2-1-3-11-23-19(24-15-21)25-17-9-12-22-13-10-17/h5-10,12-13H,1-4,11,14H2,(H2,22,23,24,25) |
| InChIKey | BOIPLTNGIAPDBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chs-828 (CHEBI:747991) has role antineoplastic agent (CHEBI:35610) |
| chs-828 (CHEBI:747991) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Chs-828 | ChEMBL |
| CHS 828 | ChEMBL |
| CHS828 | ChEMBL |
| GMX 1778 | ChEMBL |
| GMX-1778 | ChEMBL |
| GMX1778 | ChEMBL |
| Citations |
|---|