EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32N4O6 |
| Net Charge | 0 |
| Average Mass | 556.619 |
| Monoisotopic Mass | 556.23218 |
| SMILES | [H][C@]12C=Nc3cc(OCCCOc4cc5c(cc4OC)C(=O)N4CC(=C)C[C@@]4([H])C=N5)c(OC)cc3C(=O)N1CC(=C)C2 |
| InChI | InChI=1S/C31H32N4O6/c1-18-8-20-14-32-24-12-28(26(38-3)10-22(24)30(36)34(20)16-18)40-6-5-7-41-29-13-25-23(11-27(29)39-4)31(37)35-17-19(2)9-21(35)15-33-25/h10-15,20-21H,1-2,5-9,16-17H2,3-4H3/t20-,21-/m0/s1 |
| InChIKey | RWZVMMQNDHPRQD-SFTDATJTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sjg-136 (CHEBI:747990) has role antineoplastic agent (CHEBI:35610) |
| sjg-136 (CHEBI:747990) is a pyrrolobenzodiazepine (CHEBI:131437) |
| Synonyms | Source |
|---|---|
| BN-2629 | ChEMBL |
| NSC-694501 | ChEMBL |
| SG-2000 | ChEMBL |
| Sjg 136 | ChEMBL |
| Sjg-136 | ChEMBL |
| SP-2001 | ChEMBL |
| Citations |
|---|