EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O4 |
| Net Charge | 0 |
| Average Mass | 278.308 |
| Monoisotopic Mass | 278.12666 |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H18N2O4/c17-10-5-3-9(4-6-10)8-12(14(19)20)16-13(18)11-2-1-7-15-11/h3-6,11-12,15,17H,1-2,7-8H2,(H,16,18)(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | OIDKVWTWGDWMHY-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Tyr (CHEBI:74799) has role metabolite (CHEBI:25212) |
| Pro-Tyr (CHEBI:74799) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| PY | ChEBI |
| L-Pro-L-Tyr | ChEBI |
| prolyltyrosine | ChEBI |
| Prolyl-tyrosine | ChemIDplus |
| N-L-prolyl-L-tyrosine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029029 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91215 | Reaxys |
| CAS:19786-36-8 | ChemIDplus |