EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O4S |
| Net Charge | 0 |
| Average Mass | 306.343 |
| Monoisotopic Mass | 306.06743 |
| SMILES | CCOC(=O)C(=O)Nc1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C14H14N2O4S/c1-3-20-13(18)12(17)16-14-15-11(8-21-14)9-4-6-10(19-2)7-5-9/h4-8H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | ROVWYOFNUFLLNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tioxamast (CHEBI:747987) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| tioxamast | WHO MedNet |
| Citations |
|---|