EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I3NO4 |
| Net Charge | 0 |
| Average Mass | 650.976 |
| Monoisotopic Mass | 650.79005 |
| SMILES | N[C@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m1/s1 |
| InChIKey | AUYYCJSJGJYCDS-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| detrothyronine (CHEBI:747983) has role cardiovascular drug (CHEBI:35554) |
| detrothyronine (CHEBI:747983) is a phenylalanine derivative (CHEBI:25985) |
| INNs | Source |
|---|---|
| detrothyronine | WHO MedNet |
| detrotironina | WHO MedNet |
| Synonyms | Source |
|---|---|
| DT-3 | ChEMBL |
| NSC-46046 | ChEMBL |
| Rathyronine, (r)- | ChEMBL |
| Citations |
|---|