EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N4O5S |
| Net Charge | 0 |
| Average Mass | 528.675 |
| Monoisotopic Mass | 528.24064 |
| SMILES | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CC1)CN(S(C)(=O)=O)c1ccccc12 |
| InChI | InChI=1S/C27H36N4O5S/c1-26(2,28)25(33)29-22(18-36-17-20-9-5-4-6-10-20)24(32)30-15-13-27(14-16-30)19-31(37(3,34)35)23-12-8-7-11-21(23)27/h4-12,22H,13-19,28H2,1-3H3,(H,29,33)/t22-/m1/s1 |
| InChIKey | UMUPQWIGCOZEOY-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibutamoren (CHEBI:747973) has role geroprotector (CHEBI:176497) |
| ibutamoren (CHEBI:747973) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| ibutamoren | WHO MedNet |
| ibutamoreno | WHO MedNet |
| Synonym | Source |
|---|---|
| L-163,191 | ChEMBL |
| Citations |
|---|