EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O3S |
| Net Charge | 0 |
| Average Mass | 325.434 |
| Monoisotopic Mass | 325.14601 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2/N=C/N1CCCCCC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2)11(14(20)21)18-12(19)10(13(18)22-15)16-9-17-7-5-3-4-6-8-17/h9-11,13H,3-8H2,1-2H3,(H,20,21)/b16-9+/t10-,11+,13-/m1/s1 |
| InChIKey | BWWVAEOLVKTZFQ-ISVUSNJMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amdinocillin (CHEBI:747972) has role antibacterial agent (CHEBI:33282) |
| amdinocillin (CHEBI:747972) is a peptide (CHEBI:16670) |
| INN | Source |
|---|---|
| mecilinam | WHO MedNet |
| Synonyms | Source |
|---|---|
| FL 1060 | ChEMBL |
| FL-1060 | ChEMBL |
| RO 10-9070 | ChEMBL |
| RO-10-9070 | ChEMBL |
| Brand Names | Source |
|---|---|
| Selecidin | ChEMBL |
| Selexidin | ChEMBL |
| Citations |
|---|