EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O3 |
| Net Charge | 0 |
| Average Mass | 301.346 |
| Monoisotopic Mass | 301.14264 |
| SMILES | O=C(O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H19N3O3/c20-15(13-6-3-7-17-13)19-14(16(21)22)8-10-9-18-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17-18H,3,6-8H2,(H,19,20)(H,21,22)/t13-,14-/m0/s1 |
| InChIKey | UEKYKRQIAQHOOZ-KBPBESRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Trp (CHEBI:74797) has role metabolite (CHEBI:25212) |
| Pro-Trp (CHEBI:74797) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| prolyltryptophan | ChEBI |
| Prolyl-Tryptophan | HMDB |
| PW | ChEBI |
| L-Pro-L-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029028 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4762691 | Reaxys |