EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:747965 - sopromidine
| Formula | C14H23N7S |
| Net Charge | 0 |
| Average Mass | 321.454 |
| Monoisotopic Mass | 321.17356 |
| SMILES | Cc1ncnc1CSCCNC(=N)N[C@H](C)Cc1cncn1 |
| InChI | InChI=1S/C14H23N7S/c1-10(5-12-6-16-8-19-12)21-14(15)17-3-4-22-7-13-11(2)18-9-20-13/h6,8-10H,3-5,7H2,1-2H3,(H,16,19)(H,18,20)(H3,15,17,21)/t10-/m1/s1 |
| InChIKey | JXJRIXGXPTZOCF-SNVBAGLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sopromidine (CHEBI:747965) is a imidazoles (CHEBI:24780) |
| INNs | Source |
|---|---|
| sopromidina | WHO MedNet |
| sopromidine | WHO MedNet |
| Citations |
|---|