EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6Cl5NO2 |
| Net Charge | 0 |
| Average Mass | 325.406 |
| Monoisotopic Mass | 322.88412 |
| SMILES | COc1nc(C(Cl)(Cl)Cl)c(Cl)c(OC)c1Cl |
| InChI | InChI=1S/C8H6Cl5NO2/c1-15-5-3(9)6(8(11,12)13)14-7(16-2)4(5)10/h1-2H3 |
| InChIKey | DZVPGIORVGSQMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penclomedine (CHEBI:747954) has role antineoplastic agent (CHEBI:35610) |
| penclomedine (CHEBI:747954) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| NSC-338720 | ChEMBL |
| Penclomedine | ChEMBL |
| Citations |
|---|