EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27Cl2N3O4 |
| Net Charge | 0 |
| Average Mass | 468.381 |
| Monoisotopic Mass | 467.13786 |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(NC(=O)COc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C22H27Cl2N3O4/c1-4-27(5-2)11-10-25-22(29)17-12-18(24)19(13-20(17)30-3)26-21(28)14-31-16-8-6-15(23)7-9-16/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | VZNJZQAFQDEJOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloxacepride (CHEBI:747947) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| cloxaceprida | WHO MedNet |
| cloxacepride | WHO MedNet |