EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8F2N2O2 |
| Net Charge | 0 |
| Average Mass | 286.237 |
| Monoisotopic Mass | 286.05538 |
| SMILES | O=C1NC(=O)C2(N1)c1cc(F)ccc1-c1ccc(F)cc12 |
| InChI | InChI=1S/C15H8F2N2O2/c16-7-1-3-9-10-4-2-8(17)6-12(10)15(11(9)5-7)13(20)18-14(21)19-15/h1-6H,(H2,18,19,20,21) |
| InChIKey | QCCHBHSAIQIQGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imirestat (CHEBI:747946) is a fluorenes (CHEBI:24059) |
| INN | Source |
|---|---|
| imirestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| AL-1576 | ChEMBL |
| HOE 843 | ChEMBL |
| HOE-843 | ChEMBL |
| Citations |
|---|