EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N2O2 |
| Net Charge | 0 |
| Average Mass | 382.463 |
| Monoisotopic Mass | 382.16813 |
| SMILES | CC[C@H](NC(=O)c1c(O)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2/c1-2-20(17-11-5-3-6-12-17)27-25(29)22-19-15-9-10-16-21(19)26-23(24(22)28)18-13-7-4-8-14-18/h3-16,20,28H,2H2,1H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | BIAVGWDGIJKWRM-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talnetant (CHEBI:747944) has role antipsychotic agent (CHEBI:35476) |
| talnetant (CHEBI:747944) has role antispasmodic drug (CHEBI:53784) |
| talnetant (CHEBI:747944) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| talnetant | WHO MedNet |
| Synonym | Source |
|---|---|
| Sb-223412 | ChEMBL |
| Citations |
|---|