EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74794 - sulfolane
| Formula | C4H8O2S |
| Net Charge | 0 |
| Average Mass | 120.173 |
| Monoisotopic Mass | 120.02450 |
| SMILES | O=S1(=O)CCCC1 |
| InChI | InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2 |
| InChIKey | HXJUTPCZVOIRIF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfolane (CHEBI:74794) has parent hydride tetrahydrothiophene (CHEBI:48458) |
| sulfolane (CHEBI:74794) has role polar aprotic solvent (CHEBI:48358) |
| sulfolane (CHEBI:74794) is a sulfone (CHEBI:35850) |
| sulfolane (CHEBI:74794) is a tetrahydrothiophenes (CHEBI:48224) |
| IUPAC Name |
|---|
| tetrahydrothiophene 1,1-dioxide |
| Synonyms | Source |
|---|---|
| tetramethylene sulfone | ChemIDplus |
| 1,1-dioxothiolan | ChemIDplus |
| 1,1-dioxidetetrahydrothiofuran | ChemIDplus |
| 1,1-dioxidetetrahydrothiophene | ChemIDplus |
| cyclic tetramethylene sulfone | NIST Chemistry WebBook |
| thiolane-1,1-dioxide | ChemIDplus |
| Citations |
|---|