EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5O2 |
| Net Charge | 0 |
| Average Mass | 325.372 |
| Monoisotopic Mass | 325.15387 |
| SMILES | COc1ccc(OC)c(Cc2cnc3nc(N)nc(N)c3c2C)c1 |
| InChI | InChI=1S/C17H19N5O2/c1-9-11(6-10-7-12(23-2)4-5-13(10)24-3)8-20-16-14(9)15(18)21-17(19)22-16/h4-5,7-8H,6H2,1-3H3,(H4,18,19,20,21,22) |
| InChIKey | VJXSSYDSOJBUAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piritrexim (CHEBI:747920) has role antineoplastic agent (CHEBI:35610) |
| piritrexim (CHEBI:747920) is a pyridopyrimidine (CHEBI:38932) |
| INNs | Source |
|---|---|
| piritrexim | WHO MedNet |
| piritrexima | WHO MedNet |
| piritrexime | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bw 301u | ChEMBL |
| Bw-301u | ChEMBL |
| TCMDC-137235 | ChEMBL |
| Citations |
|---|