EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N3O3 |
| Net Charge | 0 |
| Average Mass | 243.307 |
| Monoisotopic Mass | 243.15829 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c12-6-2-1-4-9(11(16)17)14-10(15)8-5-3-7-13-8/h8-9,13H,1-7,12H2,(H,14,15)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | RVQDZELMXZRSSI-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Lys (CHEBI:74792) has role metabolite (CHEBI:25212) |
| Pro-Lys (CHEBI:74792) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| L-Pro-L-Lys | ChEBI |
| prolyllysine | ChEBI |
| PK | ChEBI |
| L-prolyl-L-lysine | ChEBI |
| Prolyl-Lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029022 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6865854 | Reaxys |