EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38F4N4O2S |
| Net Charge | 0 |
| Average Mass | 666.785 |
| Monoisotopic Mass | 666.26516 |
| SMILES | CCN(CC)CCN(Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)C(=O)Cn1c(SCc2ccc(F)cc2)nc(=O)c2c1CCC2 |
| InChI | InChI=1S/C36H38F4N4O2S/c1-3-42(4-2)20-21-43(22-25-8-12-27(13-9-25)28-14-16-29(17-15-28)36(38,39)40)33(45)23-44-32-7-5-6-31(32)34(46)41-35(44)47-24-26-10-18-30(37)19-11-26/h8-19H,3-7,20-24H2,1-2H3 |
| InChIKey | WDPFJWLDPVQCAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darapladib (CHEBI:747911) has role antiatherosclerotic agent (CHEBI:145947) |
| darapladib (CHEBI:747911) has role cardiovascular drug (CHEBI:35554) |
| darapladib (CHEBI:747911) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| darapladib | WHO MedNet |
| Synonym | Source |
|---|---|
| SB-480848 | ChEMBL |
| Citations |
|---|